C32H33F4N3O4 — CID 144795485
8-methoxy-2,6-dimethylquinoline;N-[3,3,3-trifluoro-2-[7-(4-fluoro-3-methylphenyl)-3,3-dimethyl-2H-furo[2,3-c]pyridin-5-yl]-2-hydroxypropyl]formamide (PubChem CID 144795485) has the molecular formula C32H33F4N3O4 and a molecular weight of 599.63 g/mol. Its IUPAC name is 8-methoxy-2,6-dimethylquinoline;N-[3,3,3-trifluoro-2-[7-(4-fluoro-3-methylphenyl)-3,3-dimethyl-2H-furo[2,3-c]pyridin-5-yl]-2-hydroxypropyl]formamide.
| Compound Name | 8-methoxy-2,6-dimethylquinoline;N-[3,3,3-trifluoro-2-[7-(4-fluoro-3-methylphenyl)-3,3-dimethyl-2H-furo[2,3-c]pyridin-5-yl]-2-hydroxypropyl]formamide |
|---|---|
| PubChem CID | 144795485 |
| Molecular Formula | C32H33F4N3O4 |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 8-methoxy-2,6-dimethylquinoline;N-[3,3,3-trifluoro-2-[7-(4-fluoro-3-methylphenyl)-3,3-dimethyl-2H-furo[2,3-c]pyridin-5-yl]-2-hydroxypropyl]formamide |
| SMILES | COc1cc(C)cc2ccc(C)nc12.Cc1cc(-c2nc(C(O)(CNC=O)C(F)(F)F)cc3c2OCC3(C)C)ccc1F |
| InChI | InChI=1S/C20H20F4N2O3.C12H13NO/c1-11-6-12(4-5-14(11)21)16-17-13(18(2,3)9-29-17)7-15(26-16)19(28,8-25-10-27)20(22,23)24;1-8-6-10-5-4-9(2)13-12(10)11(7-8)14-3/h4-7,10,28H,8-9H2,1-3H3,(H,25,27);4-7H,1-3H3 |
| InChIKey | ATYPDBZDFLFBJP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|