About CID 144796268
CID 144796268 (PubChem CID 144796268) has the molecular formula C20H22ClF4NO2S2
and a molecular weight of 483.98 g/mol.
Molecular Properties
| Compound Name | CID 144796268 |
| PubChem CID | 144796268 |
| Molecular Formula | C20H22ClF4NO2S2 |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | — |
| SMILES | CC.CC1(C)COc2c1cc(C1(C(F)(F)F)CO1)nc2-c1ccc(F)c(Cl)c1.SS |
| InChI | InChI=1S/C18H14ClF4NO2.C2H6.H2S2/c1-16(2)7-25-15-10(16)6-13(17(8-26-17)18(21,22)23)24-14(15)9-3-4-12(20)11(19)5-9;2*1-2/h3-6H,7-8H2,1-2H3;1-2H3;1-2H |
| InChIKey | YXRUXRCSANCARS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 144796268 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144796268?
The IUPAC name of CID 144796268 (CID 144796268) is not available.
What is the SMILES notation for CID 144796268?
The canonical SMILES for CID 144796268 is CC.CC1(C)COc2c1cc(C1(C(F)(F)F)CO1)nc2-c1ccc(F)c(Cl)c1.SS.
What is the InChIKey of CID 144796268?
The InChIKey is YXRUXRCSANCARS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClF4NO2.C2H6.H2S2/c1-16(2)7-25-15-10(16)6-13(17(8-26-17)18(21,22)23)24-14(15)9-3-4-12(20)11(19)5-9;2*1-2/h3-6H,7-8H2,1-2H3;1-2H3;1-2H.
What are the key properties of CID 144796268?
CID 144796268 has a molecular weight of 483.98 g/mol, XLogP of 6.79, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144796268 is sourced from PubChem (CID 144796268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).