About 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile
2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile (PubChem CID 144796289) has the molecular formula C16H15FN2O
and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile |
| PubChem CID | 144796289 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile |
| SMILES | COc1ccc(CC#N)nc1-c1ccc(F)c(C)c1C |
| InChI | InChI=1S/C16H15FN2O/c1-10-11(2)14(17)6-5-13(10)16-15(20-3)7-4-12(19-16)8-9-18/h4-7H,8H2,1-3H3 |
| InChIKey | PSEKMWXCHLIPAT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile?
The IUPAC name of 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile (CID 144796289) is 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile.
What is the SMILES notation for 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile?
The canonical SMILES for 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile is COc1ccc(CC#N)nc1-c1ccc(F)c(C)c1C.
What is the InChIKey of 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile?
The InChIKey is PSEKMWXCHLIPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O/c1-10-11(2)14(17)6-5-13(10)16-15(20-3)7-4-12(19-16)8-9-18/h4-7H,8H2,1-3H3.
What are the key properties of 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile?
2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile has a molecular weight of 270.31 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(4-fluoro-2,3-dimethylphenyl)-5-methoxy-2-pyridinyl]acetonitrile is sourced from PubChem (CID 144796289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).