C26H36BrN5O2 — CID 144797287
[8-bromo-2-[4-(4-methylpiperazin-1-yl)anilino]quinazolin-7-yl]methyl acetate;ethane (PubChem CID 144797287) has the molecular formula C26H36BrN5O2 and a molecular weight of 530.51 g/mol. Its IUPAC name is [8-bromo-2-[4-(4-methylpiperazin-1-yl)anilino]quinazolin-7-yl]methyl acetate;ethane.
| Compound Name | [8-bromo-2-[4-(4-methylpiperazin-1-yl)anilino]quinazolin-7-yl]methyl acetate;ethane |
|---|---|
| PubChem CID | 144797287 |
| Molecular Formula | C26H36BrN5O2 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | [8-bromo-2-[4-(4-methylpiperazin-1-yl)anilino]quinazolin-7-yl]methyl acetate;ethane |
| SMILES | CC.CC.CC(=O)OCc1ccc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2c1Br |
| InChI | InChI=1S/C22H24BrN5O2.2C2H6/c1-15(29)30-14-17-4-3-16-13-24-22(26-21(16)20(17)23)25-18-5-7-19(8-6-18)28-11-9-27(2)10-12-28;2*1-2/h3-8,13H,9-12,14H2,1-2H3,(H,24,25,26);2*1-2H3 |
| InChIKey | DOAGAJWJFSLYRL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|