C24H31FN4O6S — CID 144797970
S-[(E)-4-[(4Z,7S,10S)-7-ethyl-4-ethylidene-18-fluoro-5-hydroxy-2,8,12-trioxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate (PubChem CID 144797970) has the molecular formula C24H31FN4O6S and a molecular weight of 522.60 g/mol. Its IUPAC name is S-[(E)-4-[(4Z,7S,10S)-7-ethyl-4-ethylidene-18-fluoro-5-hydroxy-2,8,12-trioxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[(E)-4-[(4Z,7S,10S)-7-ethyl-4-ethylidene-18-fluoro-5-hydroxy-2,8,12-trioxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 144797970 |
| Molecular Formula | C24H31FN4O6S |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | S-[(E)-4-[(4Z,7S,10S)-7-ethyl-4-ethylidene-18-fluoro-5-hydroxy-2,8,12-trioxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate |
| SMILES | C/C=C1\NC(=O)c2nc(ccc2F)CNC(=O)C[C@@H](/C=C/CCSC(C)=O)OC(=O)[C@H](CC)NC1O |
| InChI | InChI=1S/C24H31FN4O6S/c1-4-18-22(32)29-19(5-2)24(34)35-16(8-6-7-11-36-14(3)30)12-20(31)26-13-15-9-10-17(25)21(27-15)23(33)28-18/h4,6,8-10,16,19,22,29,32H,5,7,11-13H2,1-3H3,(H,26,31)(H,28,33)/b8-6+,18-4-/t16-,19+,22?/m1/s1 |
| InChIKey | VPDCOBDWWKIUAD-VYTYYQGPSA-N |
| XLogP | 1.70 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|