C36H47F6NO3S — CID 144798206
6-(2,4-difluorophenyl)-5-[6-[(2R)-2-[3-(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylpropyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 144798206) has the molecular formula C36H47F6NO3S and a molecular weight of 687.83 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-5-[6-[(2R)-2-[3-(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylpropyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(2,4-difluorophenyl)-5-[6-[(2R)-2-[3-(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylpropyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 144798206 |
| Molecular Formula | C36H47F6NO3S |
| Molecular Weight | 687.83 g/mol |
| Exact Mass | 687.32 |
| IUPAC Name | 6-(2,4-difluorophenyl)-5-[6-[(2R)-2-[3-(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylpropyl]pyrrolidin-1-yl]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CC(F)(CCCS(=O)(=O)CCC[C@H]1CCCN1CCCCCCC1=C(c2ccc(F)cc2F)CCCc2cc(O)ccc21)C(F)(F)F |
| InChI | InChI=1S/C36H47F6NO3S/c1-35(39,36(40,41)42)19-9-23-47(45,46)22-8-12-28-11-7-21-43(28)20-5-3-2-4-13-31-30-18-16-29(44)24-26(30)10-6-14-32(31)33-17-15-27(37)25-34(33)38/h15-18,24-25,28,44H,2-14,19-23H2,1H3/t28-,35?/m1/s1 |
| InChIKey | KDQMFAVUGRLJJK-SEZSJYDQSA-N |
| XLogP | 9.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.83 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|