C11H18F5NS — CID 144798217
2-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethyl]pyrrolidine (PubChem CID 144798217) has the molecular formula C11H18F5NS and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethyl]pyrrolidine.
| Compound Name | 2-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 144798217 |
| Molecular Formula | C11H18F5NS |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethyl]pyrrolidine |
| SMILES | FC(F)(F)C(F)(F)CCCSCCC1CCCN1 |
| InChI | InChI=1S/C11H18F5NS/c12-10(13,11(14,15)16)5-2-7-18-8-4-9-3-1-6-17-9/h9,17H,1-8H2 |
| InChIKey | FSJVINQOFZQFTP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|