C22H26N2O3 — CID 144798902
(1E,4E)-1-[3-(3,4-dimethoxy-5-propylphenyl)-1H-pyrazol-5-yl]-4-ethenylhexa-1,4-dien-3-one (PubChem CID 144798902) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (1E,4E)-1-[3-(3,4-dimethoxy-5-propylphenyl)-1H-pyrazol-5-yl]-4-ethenylhexa-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[3-(3,4-dimethoxy-5-propylphenyl)-1H-pyrazol-5-yl]-4-ethenylhexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 144798902 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (1E,4E)-1-[3-(3,4-dimethoxy-5-propylphenyl)-1H-pyrazol-5-yl]-4-ethenylhexa-1,4-dien-3-one |
| SMILES | C=C/C(=C\C)C(=O)/C=C/c1cc(-c2cc(CCC)c(OC)c(OC)c2)n[nH]1 |
| InChI | InChI=1S/C22H26N2O3/c1-6-9-16-12-17(13-21(26-4)22(16)27-5)19-14-18(23-24-19)10-11-20(25)15(7-2)8-3/h7-8,10-14H,2,6,9H2,1,3-5H3,(H,23,24)/b11-10+,15-8+ |
| InChIKey | NKFOXBBXXWYOHN-OQYPFEDXSA-N |
| XLogP | 4.76 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|