C14H19ClN2 — CID 144800111
(Z,3Z,5E)-5-chloro-N-[(1E)-1-[(Z)-ethylideneamino]-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine (PubChem CID 144800111) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is (Z,3Z,5E)-5-chloro-N-[(1E)-1-[(Z)-ethylideneamino]-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine.
| Compound Name | (Z,3Z,5E)-5-chloro-N-[(1E)-1-[(Z)-ethylideneamino]-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 144800111 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (Z,3Z,5E)-5-chloro-N-[(1E)-1-[(Z)-ethylideneamino]-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine |
| SMILES | C=C/C(C)=C(\N=C/C)/N=C(C)/C=C\C(Cl)=C/C |
| InChI | InChI=1S/C14H19ClN2/c1-6-11(4)14(16-8-3)17-12(5)9-10-13(15)7-2/h6-10H,1H2,2-5H3/b10-9-,13-7+,14-11+,16-8-,17-12+ |
| InChIKey | BQVOCZCADNBFCD-YAPKTAACSA-N |
| XLogP | 4.65 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|