About ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine
ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine (PubChem CID 144800394) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine.
Molecular Properties
| Compound Name | ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine |
| PubChem CID | 144800394 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine |
| SMILES | CC.CCc1ncoc1CN |
| InChI | InChI=1S/C6H10N2O.C2H6/c1-2-5-6(3-7)9-4-8-5;1-2/h4H,2-3,7H2,1H3;1-2H3 |
| InChIKey | LUJRKZBADYTFCI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine?
The IUPAC name of ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine (CID 144800394) is ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine.
What is the SMILES notation for ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine?
The canonical SMILES for ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine is CC.CCc1ncoc1CN.
What is the InChIKey of ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine?
The InChIKey is LUJRKZBADYTFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.C2H6/c1-2-5-6(3-7)9-4-8-5;1-2/h4H,2-3,7H2,1H3;1-2H3.
What are the key properties of ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine?
ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine has a molecular weight of 156.23 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-ethyl-1,3-oxazol-5-yl)methanamine is sourced from PubChem (CID 144800394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).