About N-(ethylamino)-N'-methylhexanimidamide
N-(ethylamino)-N'-methylhexanimidamide (PubChem CID 144800585) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is N-(ethylamino)-N'-methylhexanimidamide.
Molecular Properties
| Compound Name | N-(ethylamino)-N'-methylhexanimidamide |
| PubChem CID | 144800585 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | N-(ethylamino)-N'-methylhexanimidamide |
| SMILES | CCCCC/C(=N\C)NNCC |
| InChI | InChI=1S/C9H21N3/c1-4-6-7-8-9(10-3)12-11-5-2/h11H,4-8H2,1-3H3,(H,10,12) |
| InChIKey | NVJRIISIEVZKDM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(ethylamino)-N'-methylhexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(ethylamino)-N'-methylhexanimidamide?
The IUPAC name of N-(ethylamino)-N'-methylhexanimidamide (CID 144800585) is N-(ethylamino)-N'-methylhexanimidamide.
What is the SMILES notation for N-(ethylamino)-N'-methylhexanimidamide?
The canonical SMILES for N-(ethylamino)-N'-methylhexanimidamide is CCCCC/C(=N\C)NNCC.
What is the InChIKey of N-(ethylamino)-N'-methylhexanimidamide?
The InChIKey is NVJRIISIEVZKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-4-6-7-8-9(10-3)12-11-5-2/h11H,4-8H2,1-3H3,(H,10,12).
What are the key properties of N-(ethylamino)-N'-methylhexanimidamide?
N-(ethylamino)-N'-methylhexanimidamide has a molecular weight of 171.29 g/mol, XLogP of 1.71, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(ethylamino)-N'-methylhexanimidamide is sourced from PubChem (CID 144800585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).