C18H22N7NaO2 — CID 144800693
sodium;7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carbaldehyde;methanolate (PubChem CID 144800693) has the molecular formula C18H22N7NaO2 and a molecular weight of 391.41 g/mol. Its IUPAC name is sodium;7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carbaldehyde;methanolate.
| Compound Name | sodium;7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carbaldehyde;methanolate |
|---|---|
| PubChem CID | 144800693 |
| Molecular Formula | C18H22N7NaO2 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | sodium;7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carbaldehyde;methanolate |
| SMILES | CCn1c(C=O)cc2c3c(ncn3C)c(Nc3cc(C)n(C)n3)nc21.C[O-].[Na+] |
| InChI | InChI=1S/C17H19N7O.CH3O.Na/c1-5-24-11(8-25)7-12-15-14(18-9-22(15)3)16(20-17(12)24)19-13-6-10(2)23(4)21-13;1-2;/h6-9H,5H2,1-4H3,(H,19,20,21);1H3;/q;-1;+1 |
| InChIKey | IRYIGPQLLCJRIE-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|