C14H32N2O — CID 144800701
ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane (PubChem CID 144800701) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane.
| Compound Name | ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane |
|---|---|
| PubChem CID | 144800701 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane |
| SMILES | CC.CC1CC1.COCCN1CCN(C)CC1 |
| InChI | InChI=1S/C8H18N2O.C4H8.C2H6/c1-9-3-5-10(6-4-9)7-8-11-2;1-4-2-3-4;1-2/h3-8H2,1-2H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | ITEFKNYUTSOEDT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |