About ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane
ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane (PubChem CID 144800701) has the molecular formula C14H32N2O
and a molecular weight of 244.42 g/mol. Its IUPAC name is ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane.
Molecular Properties
| Compound Name | ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane |
| PubChem CID | 144800701 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane |
| SMILES | CC.CC1CC1.COCCN1CCN(C)CC1 |
| InChI | InChI=1S/C8H18N2O.C4H8.C2H6/c1-9-3-5-10(6-4-9)7-8-11-2;1-4-2-3-4;1-2/h3-8H2,1-2H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | ITEFKNYUTSOEDT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane?
The IUPAC name of ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane (CID 144800701) is ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane.
What is the SMILES notation for ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane?
The canonical SMILES for ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane is CC.CC1CC1.COCCN1CCN(C)CC1.
What is the InChIKey of ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane?
The InChIKey is ITEFKNYUTSOEDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O.C4H8.C2H6/c1-9-3-5-10(6-4-9)7-8-11-2;1-4-2-3-4;1-2/h3-8H2,1-2H3;4H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane?
ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane has a molecular weight of 244.42 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-methoxyethyl)-4-methylpiperazine;methylcyclopropane is sourced from PubChem (CID 144800701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).