C39H40ClN5O2S — CID 144800782
4-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]methyl]-N-pyridin-2-ylsulfanylbenzamide (PubChem CID 144800782) has the molecular formula C39H40ClN5O2S and a molecular weight of 678.30 g/mol. Its IUPAC name is 4-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]methyl]-N-pyridin-2-ylsulfanylbenzamide.
| Compound Name | 4-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]methyl]-N-pyridin-2-ylsulfanylbenzamide |
|---|---|
| PubChem CID | 144800782 |
| Molecular Formula | C39H40ClN5O2S |
| Molecular Weight | 678.30 g/mol |
| Exact Mass | 677.26 |
| IUPAC Name | 4-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]methyl]-N-pyridin-2-ylsulfanylbenzamide |
| SMILES | Cc1cc(OCCCc2c(C)n(Cc3ccc(C(=O)NSc4ccccn4)cc3)c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C39H40ClN5O2S/c1-24-21-31(22-25(2)37(24)40)47-20-10-13-32-27(4)45(38-33(32)11-9-12-34(38)36-26(3)42-44(6)28(36)5)23-29-15-17-30(18-16-29)39(46)43-48-35-14-7-8-19-41-35/h7-9,11-12,14-19,21-22H,10,13,20,23H2,1-6H3,(H,43,46) |
| InChIKey | YBXWMBIVRLLZJQ-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.30 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|