C9H13F3O — CID 144800805
(3Z)-6,6,6-trifluoro-4-methoxy-5,5-dimethylhexa-1,3-diene (PubChem CID 144800805) has the molecular formula C9H13F3O and a molecular weight of 194.20 g/mol. Its IUPAC name is (3Z)-6,6,6-trifluoro-4-methoxy-5,5-dimethylhexa-1,3-diene.
| Compound Name | (3Z)-6,6,6-trifluoro-4-methoxy-5,5-dimethylhexa-1,3-diene |
|---|---|
| PubChem CID | 144800805 |
| Molecular Formula | C9H13F3O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (3Z)-6,6,6-trifluoro-4-methoxy-5,5-dimethylhexa-1,3-diene |
| SMILES | C=C/C=C(\OC)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O/c1-5-6-7(13-4)8(2,3)9(10,11)12/h5-6H,1H2,2-4H3/b7-6- |
| InChIKey | ZZBOJNIOCOZTTP-SREVYHEPSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|