About ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine
ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine (PubChem CID 144801043) has the molecular formula C12H20F3N
and a molecular weight of 235.29 g/mol. Its IUPAC name is ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine.
Molecular Properties
| Compound Name | ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine |
| PubChem CID | 144801043 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine |
| SMILES | C/C=C\N=C(/C=C\C)CCC(F)(F)F.CC |
| InChI | InChI=1S/C10H14F3N.C2H6/c1-3-5-9(14-8-4-2)6-7-10(11,12)13;1-2/h3-5,8H,6-7H2,1-2H3;1-2H3/b5-3-,8-4-,14-9+; |
| InChIKey | IOIWJDZADLIVOB-CVNTUJNESA-N |
| XLogP | 4.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine?
The IUPAC name of ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine (CID 144801043) is ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine.
What is the SMILES notation for ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine?
The canonical SMILES for ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine is C/C=C\N=C(/C=C\C)CCC(F)(F)F.CC.
What is the InChIKey of ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine?
The InChIKey is IOIWJDZADLIVOB-CVNTUJNESA-N. The full InChI is InChI=1S/C10H14F3N.C2H6/c1-3-5-9(14-8-4-2)6-7-10(11,12)13;1-2/h3-5,8H,6-7H2,1-2H3;1-2H3/b5-3-,8-4-,14-9+;.
What are the key properties of ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine?
ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine has a molecular weight of 235.29 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-7,7,7-trifluoro-N-[(Z)-prop-1-enyl]hept-2-en-4-imine is sourced from PubChem (CID 144801043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).