About 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine
3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine (PubChem CID 144801090) has the molecular formula C9H11FN2
and a molecular weight of 166.20 g/mol. Its IUPAC name is 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine |
| PubChem CID | 144801090 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine |
| SMILES | C=Cc1c(NC)ncc(F)c1C |
| InChI | InChI=1S/C9H11FN2/c1-4-7-6(2)8(10)5-12-9(7)11-3/h4-5H,1H2,2-3H3,(H,11,12) |
| InChIKey | KVTIGDYZLYXIPF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine?
The IUPAC name of 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine (CID 144801090) is 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine.
What is the SMILES notation for 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine?
The canonical SMILES for 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine is C=Cc1c(NC)ncc(F)c1C.
What is the InChIKey of 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine?
The InChIKey is KVTIGDYZLYXIPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2/c1-4-7-6(2)8(10)5-12-9(7)11-3/h4-5H,1H2,2-3H3,(H,11,12).
What are the key properties of 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine?
3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine has a molecular weight of 166.20 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-5-fluoro-N,4-dimethylpyridin-2-amine is sourced from PubChem (CID 144801090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).