About 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate
2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate (PubChem CID 14480121) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate |
| PubChem CID | 14480121 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate |
| SMILES | CCC(C)COC(=O)N1CCCCC1CCO |
| InChI | InChI=1S/C13H25NO3/c1-3-11(2)10-17-13(16)14-8-5-4-6-12(14)7-9-15/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | GQZPUJSDQXEHMT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate?
The IUPAC name of 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate (CID 14480121) is 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate.
What is the SMILES notation for 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate?
The canonical SMILES for 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate is CCC(C)COC(=O)N1CCCCC1CCO.
What is the InChIKey of 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate?
The InChIKey is GQZPUJSDQXEHMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-3-11(2)10-17-13(16)14-8-5-4-6-12(14)7-9-15/h11-12,15H,3-10H2,1-2H3.
What are the key properties of 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate?
2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate has a molecular weight of 243.35 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl 2-(2-hydroxyethyl)piperidine-1-carboxylate is sourced from PubChem (CID 14480121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).