About 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole
6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole (PubChem CID 144801663) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole.
Molecular Properties
| Compound Name | 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole |
| PubChem CID | 144801663 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole |
| SMILES | CC1(C)C=CC2=C(C=C1)NCN2 |
| InChI | InChI=1S/C10H14N2/c1-10(2)5-3-8-9(4-6-10)12-7-11-8/h3-6,11-12H,7H2,1-2H3 |
| InChIKey | OHIXZNKIKZRGFD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole?
The IUPAC name of 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole (CID 144801663) is 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole.
What is the SMILES notation for 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole?
The canonical SMILES for 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole is CC1(C)C=CC2=C(C=C1)NCN2.
What is the InChIKey of 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole?
The InChIKey is OHIXZNKIKZRGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-10(2)5-3-8-9(4-6-10)12-7-11-8/h3-6,11-12H,7H2,1-2H3.
What are the key properties of 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole?
6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole has a molecular weight of 162.24 g/mol, XLogP of 1.50, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-2,3-dihydro-1H-cyclohepta[d]imidazole is sourced from PubChem (CID 144801663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).