C34H42ClF2N7O — CID 144801813
4-[[8-[4-(4-chlorophenyl)-4-(2,2-difluoroethyl)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzaldehyde;N,N,1-trimethylpiperidin-4-amine (PubChem CID 144801813) has the molecular formula C34H42ClF2N7O and a molecular weight of 638.21 g/mol. Its IUPAC name is 4-[[8-[4-(4-chlorophenyl)-4-(2,2-difluoroethyl)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzaldehyde;N,N,1-trimethylpiperidin-4-amine.
| Compound Name | 4-[[8-[4-(4-chlorophenyl)-4-(2,2-difluoroethyl)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzaldehyde;N,N,1-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 144801813 |
| Molecular Formula | C34H42ClF2N7O |
| Molecular Weight | 638.21 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | 4-[[8-[4-(4-chlorophenyl)-4-(2,2-difluoroethyl)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzaldehyde;N,N,1-trimethylpiperidin-4-amine |
| SMILES | CN1CCC(N(C)C)CC1.O=Cc1ccc(Nc2nc3c(N4CCC(CC(F)F)(c5ccc(Cl)cc5)CC4)cccn3n2)cc1 |
| InChI | InChI=1S/C26H24ClF2N5O.C8H18N2/c27-20-7-5-19(6-8-20)26(16-23(28)29)11-14-33(15-12-26)22-2-1-13-34-24(22)31-25(32-34)30-21-9-3-18(17-35)4-10-21;1-9(2)8-4-6-10(3)7-5-8/h1-10,13,17,23H,11-12,14-16H2,(H,30,32);8H,4-7H2,1-3H3 |
| InChIKey | UKOZWWMNQSYOQP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.21 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|