C39H34BN3O2 — CID 144803727
2,6-bis(4-pyridin-4-ylphenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 144803727) has the molecular formula C39H34BN3O2 and a molecular weight of 587.53 g/mol. Its IUPAC name is 2,6-bis(4-pyridin-4-ylphenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2,6-bis(4-pyridin-4-ylphenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 144803727 |
| Molecular Formula | C39H34BN3O2 |
| Molecular Weight | 587.53 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 2,6-bis(4-pyridin-4-ylphenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC1(C)OB(c2ccc(-c3cc(-c4ccc(-c5ccncc5)cc4)nc(-c4ccc(-c5ccncc5)cc4)c3)cc2)OC1(C)C |
| InChI | InChI=1S/C39H34BN3O2/c1-38(2)39(3,4)45-40(44-38)35-15-13-29(14-16-35)34-25-36(32-9-5-27(6-10-32)30-17-21-41-22-18-30)43-37(26-34)33-11-7-28(8-12-33)31-19-23-42-24-20-31/h5-26H,1-4H3 |
| InChIKey | LIBCDFYWOGVZJQ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.53 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|