About ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol
ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol (PubChem CID 144803967) has the molecular formula C13H28O4
and a molecular weight of 248.36 g/mol. Its IUPAC name is ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol.
Molecular Properties
| Compound Name | ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol |
| PubChem CID | 144803967 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol |
| SMILES | CC.CCCOCC1(CO)COC(CC)OC1 |
| InChI | InChI=1S/C11H22O4.C2H6/c1-3-5-13-7-11(6-12)8-14-10(4-2)15-9-11;1-2/h10,12H,3-9H2,1-2H3;1-2H3 |
| InChIKey | BSOWECSRVKUUKU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol?
The IUPAC name of ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol (CID 144803967) is ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol.
What is the SMILES notation for ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol?
The canonical SMILES for ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol is CC.CCCOCC1(CO)COC(CC)OC1.
What is the InChIKey of ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol?
The InChIKey is BSOWECSRVKUUKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4.C2H6/c1-3-5-13-7-11(6-12)8-14-10(4-2)15-9-11;1-2/h10,12H,3-9H2,1-2H3;1-2H3.
What are the key properties of ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol?
ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol has a molecular weight of 248.36 g/mol, XLogP of 2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[2-ethyl-5-(propoxymethyl)-1,3-dioxan-5-yl]methanol is sourced from PubChem (CID 144803967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).