C20H27FO — CID 144804583
3-ethoxy-4-fluoro-1-[(3E,5E)-5,6,7-trimethylocta-1,3,5-trien-3-yl]bicyclo[4.1.0]hepta-2,4-diene (PubChem CID 144804583) has the molecular formula C20H27FO and a molecular weight of 302.43 g/mol. Its IUPAC name is 3-ethoxy-4-fluoro-1-[(3E,5E)-5,6,7-trimethylocta-1,3,5-trien-3-yl]bicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 3-ethoxy-4-fluoro-1-[(3E,5E)-5,6,7-trimethylocta-1,3,5-trien-3-yl]bicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 144804583 |
| Molecular Formula | C20H27FO |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3-ethoxy-4-fluoro-1-[(3E,5E)-5,6,7-trimethylocta-1,3,5-trien-3-yl]bicyclo[4.1.0]hepta-2,4-diene |
| SMILES | C=C/C(=C\C(C)=C(/C)C(C)C)C12C=C(OCC)C(F)=CC1C2 |
| InChI | InChI=1S/C20H27FO/c1-7-16(9-14(5)15(6)13(3)4)20-11-17(20)10-18(21)19(12-20)22-8-2/h7,9-10,12-13,17H,1,8,11H2,2-6H3/b15-14+,16-9+ |
| InChIKey | ADXOEKNWBQNTQI-JWTAZNJOSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|