C11H17FO — CID 144804642
(3Z,5E)-2-fluoro-6-methoxy-5-propan-2-ylhepta-1,3,5-triene (PubChem CID 144804642) has the molecular formula C11H17FO and a molecular weight of 184.25 g/mol. Its IUPAC name is (3Z,5E)-2-fluoro-6-methoxy-5-propan-2-ylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-2-fluoro-6-methoxy-5-propan-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144804642 |
| Molecular Formula | C11H17FO |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (3Z,5E)-2-fluoro-6-methoxy-5-propan-2-ylhepta-1,3,5-triene |
| SMILES | C=C(F)/C=C\C(=C(/C)OC)C(C)C |
| InChI | InChI=1S/C11H17FO/c1-8(2)11(10(4)13-5)7-6-9(3)12/h6-8H,3H2,1-2,4-5H3/b7-6-,11-10- |
| InChIKey | LSPXTFBDLJFPKY-QOXWLJPHSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|