C22H41NO — CID 144804933
(2E)-N-[2-(4-ethyl-2,2,3,3-tetramethylcyclopentyl)oxyethyl]-7-methylocta-2,6-dien-1-amine (PubChem CID 144804933) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is (2E)-N-[2-(4-ethyl-2,2,3,3-tetramethylcyclopentyl)oxyethyl]-7-methylocta-2,6-dien-1-amine.
| Compound Name | (2E)-N-[2-(4-ethyl-2,2,3,3-tetramethylcyclopentyl)oxyethyl]-7-methylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 144804933 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | (2E)-N-[2-(4-ethyl-2,2,3,3-tetramethylcyclopentyl)oxyethyl]-7-methylocta-2,6-dien-1-amine |
| SMILES | CCC1CC(OCCNC/C=C/CCC=C(C)C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C22H41NO/c1-8-19-17-20(22(6,7)21(19,4)5)24-16-15-23-14-12-10-9-11-13-18(2)3/h10,12-13,19-20,23H,8-9,11,14-17H2,1-7H3/b12-10+ |
| InChIKey | CAMHFALRDXVMAE-ZRDIBKRKSA-N |
| XLogP | 5.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|