C17H23F2NO — CID 144804946
N-[2-[[(1S)-1,3-dimethyl-6-bicyclo[3.1.1]heptanyl]oxy]ethyl]-2,4-difluoroaniline (PubChem CID 144804946) has the molecular formula C17H23F2NO and a molecular weight of 295.37 g/mol. Its IUPAC name is N-[2-[[(1S)-1,3-dimethyl-6-bicyclo[3.1.1]heptanyl]oxy]ethyl]-2,4-difluoroaniline.
| Compound Name | N-[2-[[(1S)-1,3-dimethyl-6-bicyclo[3.1.1]heptanyl]oxy]ethyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 144804946 |
| Molecular Formula | C17H23F2NO |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[2-[[(1S)-1,3-dimethyl-6-bicyclo[3.1.1]heptanyl]oxy]ethyl]-2,4-difluoroaniline |
| SMILES | CC1CC2C[C@](C)(C1)C2OCCNc1ccc(F)cc1F |
| InChI | InChI=1S/C17H23F2NO/c1-11-7-12-10-17(2,9-11)16(12)21-6-5-20-15-4-3-13(18)8-14(15)19/h3-4,8,11-12,16,20H,5-7,9-10H2,1-2H3/t11?,12?,16?,17-/m0/s1 |
| InChIKey | ICGSORONGJVJCD-OUYDNOHKSA-N |
| XLogP | 4.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|