C15H15F6NO2S — CID 144804985
ethyl 2-[7-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,4-dihydro-2H-1,4-benzothiazin-3-yl]acetate (PubChem CID 144804985) has the molecular formula C15H15F6NO2S and a molecular weight of 387.35 g/mol. Its IUPAC name is ethyl 2-[7-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,4-dihydro-2H-1,4-benzothiazin-3-yl]acetate.
| Compound Name | ethyl 2-[7-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,4-dihydro-2H-1,4-benzothiazin-3-yl]acetate |
|---|---|
| PubChem CID | 144804985 |
| Molecular Formula | C15H15F6NO2S |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | ethyl 2-[7-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3,4-dihydro-2H-1,4-benzothiazin-3-yl]acetate |
| SMILES | CCOC(=O)CC1CSc2cc(C(C(F)(F)F)C(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C15H15F6NO2S/c1-2-24-12(23)6-9-7-25-11-5-8(3-4-10(11)22-9)13(14(16,17)18)15(19,20)21/h3-5,9,13,22H,2,6-7H2,1H3 |
| InChIKey | CJQKJSRCOLHYQT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |