About methylcyclopentane;(E)-3-methylpent-3-en-2-imine
methylcyclopentane;(E)-3-methylpent-3-en-2-imine (PubChem CID 144805325) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is methylcyclopentane;(E)-3-methylpent-3-en-2-imine.
Molecular Properties
| Compound Name | methylcyclopentane;(E)-3-methylpent-3-en-2-imine |
| PubChem CID | 144805325 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | methylcyclopentane;(E)-3-methylpent-3-en-2-imine |
| SMILES | CC1CCCC1.[H]/N=C(C)/C(C)=C/C |
| InChI | InChI=1S/C6H11N.C6H12/c1-4-5(2)6(3)7;1-6-4-2-3-5-6/h4,7H,1-3H3;6H,2-5H2,1H3/b5-4+,7-6+; |
| InChIKey | SSRQGGVLDQOTNQ-QDGXTOJKSA-N |
| XLogP | 4.19 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methylcyclopentane;(E)-3-methylpent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclopentane;(E)-3-methylpent-3-en-2-imine?
The IUPAC name of methylcyclopentane;(E)-3-methylpent-3-en-2-imine (CID 144805325) is methylcyclopentane;(E)-3-methylpent-3-en-2-imine.
What is the SMILES notation for methylcyclopentane;(E)-3-methylpent-3-en-2-imine?
The canonical SMILES for methylcyclopentane;(E)-3-methylpent-3-en-2-imine is CC1CCCC1.[H]/N=C(C)/C(C)=C/C.
What is the InChIKey of methylcyclopentane;(E)-3-methylpent-3-en-2-imine?
The InChIKey is SSRQGGVLDQOTNQ-QDGXTOJKSA-N. The full InChI is InChI=1S/C6H11N.C6H12/c1-4-5(2)6(3)7;1-6-4-2-3-5-6/h4,7H,1-3H3;6H,2-5H2,1H3/b5-4+,7-6+;.
What are the key properties of methylcyclopentane;(E)-3-methylpent-3-en-2-imine?
methylcyclopentane;(E)-3-methylpent-3-en-2-imine has a molecular weight of 181.32 g/mol, XLogP of 4.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclopentane;(E)-3-methylpent-3-en-2-imine is sourced from PubChem (CID 144805325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).