C19H31NS — CID 144805366
(2E,4E)-N,N-diethyl-4-[(4Z)-2-methylhepta-2,4-dien-3-yl]sulfanylhepta-2,4,6-trien-3-amine (PubChem CID 144805366) has the molecular formula C19H31NS and a molecular weight of 305.53 g/mol. Its IUPAC name is (2E,4E)-N,N-diethyl-4-[(4Z)-2-methylhepta-2,4-dien-3-yl]sulfanylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-N,N-diethyl-4-[(4Z)-2-methylhepta-2,4-dien-3-yl]sulfanylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 144805366 |
| Molecular Formula | C19H31NS |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (2E,4E)-N,N-diethyl-4-[(4Z)-2-methylhepta-2,4-dien-3-yl]sulfanylhepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(SC(/C=C\CC)=C(C)C)\C(=C/C)N(CC)CC |
| InChI | InChI=1S/C19H31NS/c1-8-13-15-18(16(6)7)21-19(14-9-2)17(10-3)20(11-4)12-5/h9-10,13-15H,2,8,11-12H2,1,3-7H3/b15-13-,17-10+,19-14+ |
| InChIKey | MGXFVGLUBBBFDC-OKVFLNSDSA-N |
| XLogP | 6.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|