C22H26FNO3S — CID 144805895
3-[4-[butyl(dimethyl)-λ4-sulfanyl]oxy-3-fluorophenyl]-5-methoxy-2H-isoquinolin-1-one (PubChem CID 144805895) has the molecular formula C22H26FNO3S and a molecular weight of 403.52 g/mol. Its IUPAC name is 3-[4-[butyl(dimethyl)-λ4-sulfanyl]oxy-3-fluorophenyl]-5-methoxy-2H-isoquinolin-1-one.
| Compound Name | 3-[4-[butyl(dimethyl)-λ4-sulfanyl]oxy-3-fluorophenyl]-5-methoxy-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 144805895 |
| Molecular Formula | C22H26FNO3S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 3-[4-[butyl(dimethyl)-λ4-sulfanyl]oxy-3-fluorophenyl]-5-methoxy-2H-isoquinolin-1-one |
| SMILES | CCCCS(C)(C)Oc1ccc(-c2cc3c(OC)cccc3c(=O)[nH]2)cc1F |
| InChI | InChI=1S/C22H26FNO3S/c1-5-6-12-28(3,4)27-21-11-10-15(13-18(21)23)19-14-17-16(22(25)24-19)8-7-9-20(17)26-2/h7-11,13-14H,5-6,12H2,1-4H3,(H,24,25) |
| InChIKey | URTOWZOTOUFUOZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |