C18H18N2 — CID 144806345
3-cyclohexa-1,5-dien-1-yl-5-(1,2,3,6-tetrahydropyridin-2-yl)benzonitrile (PubChem CID 144806345) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-5-(1,2,3,6-tetrahydropyridin-2-yl)benzonitrile.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-5-(1,2,3,6-tetrahydropyridin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 144806345 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-5-(1,2,3,6-tetrahydropyridin-2-yl)benzonitrile |
| SMILES | N#Cc1cc(C2=CCCC=C2)cc(C2CC=CCN2)c1 |
| InChI | InChI=1S/C18H18N2/c19-13-14-10-16(15-6-2-1-3-7-15)12-17(11-14)18-8-4-5-9-20-18/h2,4-7,10-12,18,20H,1,3,8-9H2 |
| InChIKey | BSRPAKAVIBNLGP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|