C29H43NO5Si — CID 144807237
tert-butyl N-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]carbamate (PubChem CID 144807237) has the molecular formula C29H43NO5Si and a molecular weight of 513.75 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 144807237 |
| Molecular Formula | C29H43NO5Si |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | tert-butyl N-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]carbamate |
| SMILES | C[C@H]1OC(C)(C)O[C@H]1[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H43NO5Si/c1-21-25(34-29(8,9)33-21)24(30-26(31)35-27(2,3)4)20-32-36(28(5,6)7,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-19,21,24-25H,20H2,1-9H3,(H,30,31)/t21-,24+,25-/m1/s1 |
| InChIKey | YXLXXDQDCYNKSK-IEZKXTBUSA-N |
| XLogP | 5.00 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|