C23H39F2N2OP — CID 144807396
(Z,2E)-7,7-difluoro-5-methyl-7-phosphanyl-1-piperidin-1-yl-2-prop-2-enylidenehept-3-en-1-one;1,4-dimethylpiperidine (PubChem CID 144807396) has the molecular formula C23H39F2N2OP and a molecular weight of 428.55 g/mol. Its IUPAC name is (Z,2E)-7,7-difluoro-5-methyl-7-phosphanyl-1-piperidin-1-yl-2-prop-2-enylidenehept-3-en-1-one;1,4-dimethylpiperidine.
| Compound Name | (Z,2E)-7,7-difluoro-5-methyl-7-phosphanyl-1-piperidin-1-yl-2-prop-2-enylidenehept-3-en-1-one;1,4-dimethylpiperidine |
|---|---|
| PubChem CID | 144807396 |
| Molecular Formula | C23H39F2N2OP |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (Z,2E)-7,7-difluoro-5-methyl-7-phosphanyl-1-piperidin-1-yl-2-prop-2-enylidenehept-3-en-1-one;1,4-dimethylpiperidine |
| SMILES | C=C/C=C(\C=C/C(C)CC(F)(F)P)C(=O)N1CCCCC1.CC1CCN(C)CC1 |
| InChI | InChI=1S/C16H24F2NOP.C7H15N/c1-3-7-14(9-8-13(2)12-16(17,18)21)15(20)19-10-5-4-6-11-19;1-7-3-5-8(2)6-4-7/h3,7-9,13H,1,4-6,10-12,21H2,2H3;7H,3-6H2,1-2H3/b9-8-,14-7+; |
| InChIKey | OVKYAFGLUHJGSX-BVWQAOHPSA-N |
| XLogP | 5.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|