About 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne
4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne (PubChem CID 144807516) has the molecular formula C23H37NS
and a molecular weight of 359.62 g/mol. Its IUPAC name is 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne.
Molecular Properties
| Compound Name | 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne |
| PubChem CID | 144807516 |
| Molecular Formula | C23H37NS |
| Molecular Weight | 359.62 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne |
| SMILES | C#CCC(CCC)CCCC.CC1CCN(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C12H17NS.C11H20/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12;1-4-7-10-11(8-5-2)9-6-3/h2-6,11H,7-10H2,1H3;2,11H,4,6-10H2,1,3H3 |
| InChIKey | PVBPGBCCNRDLDX-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne?
The IUPAC name of 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne (CID 144807516) is 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne.
What is the SMILES notation for 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne?
The canonical SMILES for 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne is C#CCC(CCC)CCCC.CC1CCN(Sc2ccccc2)CC1.
What is the InChIKey of 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne?
The InChIKey is PVBPGBCCNRDLDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS.C11H20/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12;1-4-7-10-11(8-5-2)9-6-3/h2-6,11H,7-10H2,1H3;2,11H,4,6-10H2,1,3H3.
What are the key properties of 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne?
4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne has a molecular weight of 359.62 g/mol, XLogP of 7.04, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-phenylsulfanylpiperidine;4-propyloct-1-yne is sourced from PubChem (CID 144807516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).