About ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate
ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate (PubChem CID 144807892) has the molecular formula C19H18N2O6S
and a molecular weight of 402.43 g/mol. Its IUPAC name is ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate |
| PubChem CID | 144807892 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2S(=O)(=O)C2=CCCC=C2)cc(O)c1=O |
| InChI | InChI=1S/C19H18N2O6S/c1-2-27-19(24)17-18(23)15(22)12-21(20-17)14-10-6-7-11-16(14)28(25,26)13-8-4-3-5-9-13/h4,6-12,22H,2-3,5H2,1H3 |
| InChIKey | ARTYSVWEQIAQCZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate?
The IUPAC name of ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate (CID 144807892) is ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate.
What is the SMILES notation for ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate?
The canonical SMILES for ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate is CCOC(=O)c1nn(-c2ccccc2S(=O)(=O)C2=CCCC=C2)cc(O)c1=O.
What is the InChIKey of ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate?
The InChIKey is ARTYSVWEQIAQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O6S/c1-2-27-19(24)17-18(23)15(22)12-21(20-17)14-10-6-7-11-16(14)28(25,26)13-8-4-3-5-9-13/h4,6-12,22H,2-3,5H2,1H3.
What are the key properties of ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate?
ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate has a molecular weight of 402.43 g/mol, XLogP of 2.12, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2-cyclohexa-1,5-dien-1-ylsulfonylphenyl)-5-hydroxy-4-oxopyridazine-3-carboxylate is sourced from PubChem (CID 144807892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).