C17H14N2O6S — CID 144808065
1-[2-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylphenyl]-5-hydroxy-4-oxopyridazine-3-carboxylic acid (PubChem CID 144808065) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is 1-[2-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylphenyl]-5-hydroxy-4-oxopyridazine-3-carboxylic acid.
| Compound Name | 1-[2-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylphenyl]-5-hydroxy-4-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 144808065 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1-[2-[(3E)-hexa-1,3,5-trien-3-yl]sulfonylphenyl]-5-hydroxy-4-oxopyridazine-3-carboxylic acid |
| SMILES | C=C/C=C(\C=C)S(=O)(=O)c1ccccc1-n1cc(O)c(=O)c(C(=O)O)n1 |
| InChI | InChI=1S/C17H14N2O6S/c1-3-7-11(4-2)26(24,25)14-9-6-5-8-12(14)19-10-13(20)16(21)15(18-19)17(22)23/h3-10,20H,1-2H2,(H,22,23)/b11-7+ |
| InChIKey | CEARPCLDZKAKJH-YRNVUSSQSA-N |
| XLogP | 1.67 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|