C18H16N2O2S2 — CID 144808645
(1E,6E)-4-(1,3-dithiolan-2-ylidene)-1,7-bis(1H-pyrrol-2-yl)hepta-1,6-diene-3,5-dione (PubChem CID 144808645) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (1E,6E)-4-(1,3-dithiolan-2-ylidene)-1,7-bis(1H-pyrrol-2-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4-(1,3-dithiolan-2-ylidene)-1,7-bis(1H-pyrrol-2-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 144808645 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (1E,6E)-4-(1,3-dithiolan-2-ylidene)-1,7-bis(1H-pyrrol-2-yl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/c1ccc[nH]1)C(C(=O)/C=C/c1ccc[nH]1)=C1SCCS1 |
| InChI | InChI=1S/C18H16N2O2S2/c21-15(7-5-13-3-1-9-19-13)17(18-23-11-12-24-18)16(22)8-6-14-4-2-10-20-14/h1-10,19-20H,11-12H2/b7-5+,8-6+ |
| InChIKey | GIWZLHOJVWKTQN-KQQUZDAGSA-N |
| XLogP | 3.90 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|