C13H23FN2 — CID 144808674
N-[(1E,5E)-4-ethyl-6-fluorohexa-1,5-dienyl]piperidin-4-amine (PubChem CID 144808674) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is N-[(1E,5E)-4-ethyl-6-fluorohexa-1,5-dienyl]piperidin-4-amine.
| Compound Name | N-[(1E,5E)-4-ethyl-6-fluorohexa-1,5-dienyl]piperidin-4-amine |
|---|---|
| PubChem CID | 144808674 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | N-[(1E,5E)-4-ethyl-6-fluorohexa-1,5-dienyl]piperidin-4-amine |
| SMILES | CCC(/C=C/F)C/C=C/NC1CCNCC1 |
| InChI | InChI=1S/C13H23FN2/c1-2-12(5-8-14)4-3-9-16-13-6-10-15-11-7-13/h3,5,8-9,12-13,15-16H,2,4,6-7,10-11H2,1H3/b8-5+,9-3+ |
| InChIKey | XMWIDACXUHCIOI-MXJIWBSISA-N |
| XLogP | 2.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |