C11H18FNO — CID 144808712
(2E,6E)-N,5-diethyl-7-fluorohepta-2,6-dienamide (PubChem CID 144808712) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is (2E,6E)-N,5-diethyl-7-fluorohepta-2,6-dienamide.
| Compound Name | (2E,6E)-N,5-diethyl-7-fluorohepta-2,6-dienamide |
|---|---|
| PubChem CID | 144808712 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (2E,6E)-N,5-diethyl-7-fluorohepta-2,6-dienamide |
| SMILES | CCNC(=O)/C=C/CC(/C=C/F)CC |
| InChI | InChI=1S/C11H18FNO/c1-3-10(8-9-12)6-5-7-11(14)13-4-2/h5,7-10H,3-4,6H2,1-2H3,(H,13,14)/b7-5+,9-8+ |
| InChIKey | WPFMPQGBRVVEOL-ZIRGRKGMSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|