About (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol
(1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol (PubChem CID 144808720) has the molecular formula C12H20FNOS
and a molecular weight of 245.36 g/mol. Its IUPAC name is (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol.
Molecular Properties
| Compound Name | (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol |
| PubChem CID | 144808720 |
| Molecular Formula | C12H20FNOS |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol |
| SMILES | C/C=C(OCCN1CCCCC1)\C(F)=C/S |
| InChI | InChI=1S/C12H20FNOS/c1-2-12(11(13)10-16)15-9-8-14-6-4-3-5-7-14/h2,10,16H,3-9H2,1H3/b11-10+,12-2+ |
| InChIKey | DVIFNCZGCHWCLS-IVLNBQDGSA-N |
| XLogP | 3.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol?
The IUPAC name of (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol (CID 144808720) is (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol.
What is the SMILES notation for (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol?
The canonical SMILES for (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol is C/C=C(OCCN1CCCCC1)\C(F)=C/S.
What is the InChIKey of (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol?
The InChIKey is DVIFNCZGCHWCLS-IVLNBQDGSA-N. The full InChI is InChI=1S/C12H20FNOS/c1-2-12(11(13)10-16)15-9-8-14-6-4-3-5-7-14/h2,10,16H,3-9H2,1H3/b11-10+,12-2+.
What are the key properties of (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol?
(1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol has a molecular weight of 245.36 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-2-fluoro-3-(2-piperidin-1-ylethoxy)penta-1,3-diene-1-thiol is sourced from PubChem (CID 144808720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).