About (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine
(2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine (PubChem CID 144808802) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine |
| PubChem CID | 144808802 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine |
| SMILES | C=C/C=C1/OC2=C(CCC=C2)N(CCC)C1=C(C)C |
| InChI | InChI=1S/C17H23NO/c1-5-9-16-17(13(3)4)18(12-6-2)14-10-7-8-11-15(14)19-16/h5,8-9,11H,1,6-7,10,12H2,2-4H3/b16-9+ |
| InChIKey | VLXBKAYKGHYLBG-CXUHLZMHSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine?
The IUPAC name of (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine (CID 144808802) is (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine.
What is the SMILES notation for (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine?
The canonical SMILES for (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine is C=C/C=C1/OC2=C(CCC=C2)N(CCC)C1=C(C)C.
What is the InChIKey of (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine?
The InChIKey is VLXBKAYKGHYLBG-CXUHLZMHSA-N. The full InChI is InChI=1S/C17H23NO/c1-5-9-16-17(13(3)4)18(12-6-2)14-10-7-8-11-15(14)19-16/h5,8-9,11H,1,6-7,10,12H2,2-4H3/b16-9+.
What are the key properties of (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine?
(2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine has a molecular weight of 257.38 g/mol, XLogP of 4.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-propan-2-ylidene-2-prop-2-enylidene-4-propyl-5,6-dihydro-1,4-benzoxazine is sourced from PubChem (CID 144808802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).