C20H21N — CID 144808877
6-(5-buta-1,3-dien-2-yl-2-methylphenyl)-4,5-bis(ethenyl)-1,2-dihydropyridine (PubChem CID 144808877) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 6-(5-buta-1,3-dien-2-yl-2-methylphenyl)-4,5-bis(ethenyl)-1,2-dihydropyridine.
| Compound Name | 6-(5-buta-1,3-dien-2-yl-2-methylphenyl)-4,5-bis(ethenyl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 144808877 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 6-(5-buta-1,3-dien-2-yl-2-methylphenyl)-4,5-bis(ethenyl)-1,2-dihydropyridine |
| SMILES | C=CC(=C)c1ccc(C)c(C2=C(C=C)C(C=C)=CCN2)c1 |
| InChI | InChI=1S/C20H21N/c1-6-14(4)17-10-9-15(5)19(13-17)20-18(8-3)16(7-2)11-12-21-20/h6-11,13,21H,1-4,12H2,5H3 |
| InChIKey | RSBLRHARXHJSDY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|