C26H52N2O9 — CID 144809075
N-[(2S,3S,4R)-1-[6-(6-aminohexoxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4-dihydroxypentan-2-yl]nonanamide (PubChem CID 144809075) has the molecular formula C26H52N2O9 and a molecular weight of 536.71 g/mol. Its IUPAC name is N-[(2S,3S,4R)-1-[6-(6-aminohexoxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4-dihydroxypentan-2-yl]nonanamide.
| Compound Name | N-[(2S,3S,4R)-1-[6-(6-aminohexoxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4-dihydroxypentan-2-yl]nonanamide |
|---|---|
| PubChem CID | 144809075 |
| Molecular Formula | C26H52N2O9 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | N-[(2S,3S,4R)-1-[6-(6-aminohexoxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4-dihydroxypentan-2-yl]nonanamide |
| SMILES | CCCCCCCCC(=O)N[C@@H](COC1OC(COCCCCCCN)C(O)C(O)C1O)[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C26H52N2O9/c1-3-4-5-6-7-10-13-21(30)28-19(22(31)18(2)29)16-36-26-25(34)24(33)23(32)20(37-26)17-35-15-12-9-8-11-14-27/h18-20,22-26,29,31-34H,3-17,27H2,1-2H3,(H,28,30)/t18-,19+,20?,22-,23?,24?,25?,26?/m1/s1 |
| InChIKey | QOTMGKBJDWGYSY-JTNVQMMWSA-N |
| XLogP | 0.32 |
| TPSA | 183.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|