C24H30ClN3O — CID 144809113
7-(3-chloropropoxy)-N-[(4Z,6Z)-4-propan-2-yldeca-4,6,8,9-tetraenyl]quinazolin-4-amine (PubChem CID 144809113) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is 7-(3-chloropropoxy)-N-[(4Z,6Z)-4-propan-2-yldeca-4,6,8,9-tetraenyl]quinazolin-4-amine.
| Compound Name | 7-(3-chloropropoxy)-N-[(4Z,6Z)-4-propan-2-yldeca-4,6,8,9-tetraenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 144809113 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 7-(3-chloropropoxy)-N-[(4Z,6Z)-4-propan-2-yldeca-4,6,8,9-tetraenyl]quinazolin-4-amine |
| SMILES | C=C=C/C=C\C=C(\CCCNc1ncnc2cc(OCCCCl)ccc12)C(C)C |
| InChI | InChI=1S/C24H30ClN3O/c1-4-5-6-7-10-20(19(2)3)11-8-15-26-24-22-13-12-21(29-16-9-14-25)17-23(22)27-18-28-24/h5-7,10,12-13,17-19H,1,8-9,11,14-16H2,2-3H3,(H,26,27,28)/b7-6-,20-10- |
| InChIKey | PTKODDLLJBHMFH-BQOBSDRZSA-N |
| XLogP | 6.31 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|