C19H32F4S — CID 144809471
7,7,8,8-tetrafluoro-5,10,13-trimethyl-6,9-dimethylidenetetradecane-2-thiol (PubChem CID 144809471) has the molecular formula C19H32F4S and a molecular weight of 368.52 g/mol. Its IUPAC name is 7,7,8,8-tetrafluoro-5,10,13-trimethyl-6,9-dimethylidenetetradecane-2-thiol.
| Compound Name | 7,7,8,8-tetrafluoro-5,10,13-trimethyl-6,9-dimethylidenetetradecane-2-thiol |
|---|---|
| PubChem CID | 144809471 |
| Molecular Formula | C19H32F4S |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 7,7,8,8-tetrafluoro-5,10,13-trimethyl-6,9-dimethylidenetetradecane-2-thiol |
| SMILES | C=C(C(C)CCC(C)C)C(F)(F)C(F)(F)C(=C)C(C)CCC(C)S |
| InChI | InChI=1S/C19H32F4S/c1-12(2)8-9-13(3)16(6)18(20,21)19(22,23)17(7)14(4)10-11-15(5)24/h12-15,24H,6-11H2,1-5H3 |
| InChIKey | QBTVPRYKGVIPMU-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|