C25H33F4N — CID 144809478
N-methyl-4-[4-[4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclohexyl]cyclohexan-1-amine (PubChem CID 144809478) has the molecular formula C25H33F4N and a molecular weight of 423.54 g/mol. Its IUPAC name is N-methyl-4-[4-[4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclohexyl]cyclohexan-1-amine.
| Compound Name | N-methyl-4-[4-[4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclohexyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 144809478 |
| Molecular Formula | C25H33F4N |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-methyl-4-[4-[4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,5-dien-1-yl]cyclohexyl]cyclohexan-1-amine |
| SMILES | CNC1CCC(C2CCC(C3=CCC(C4=CC=CC(F)(F)C4(F)F)C=C3)CC2)CC1 |
| InChI | InChI=1S/C25H33F4N/c1-30-22-14-12-20(13-15-22)18-6-4-17(5-7-18)19-8-10-21(11-9-19)23-3-2-16-24(26,27)25(23,28)29/h2-3,8-10,16-18,20-22,30H,4-7,11-15H2,1H3 |
| InChIKey | NGGYOCKPPDFSQU-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|