C14H16F6O — CID 144809491
1-[cyclohexyloxy(difluoro)methyl]-5,5,6,6-tetrafluoro-4-methylcyclohexa-1,3-diene (PubChem CID 144809491) has the molecular formula C14H16F6O and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-[cyclohexyloxy(difluoro)methyl]-5,5,6,6-tetrafluoro-4-methylcyclohexa-1,3-diene.
| Compound Name | 1-[cyclohexyloxy(difluoro)methyl]-5,5,6,6-tetrafluoro-4-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144809491 |
| Molecular Formula | C14H16F6O |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-[cyclohexyloxy(difluoro)methyl]-5,5,6,6-tetrafluoro-4-methylcyclohexa-1,3-diene |
| SMILES | CC1=CC=C(C(F)(F)OC2CCCCC2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H16F6O/c1-9-7-8-11(13(17,18)12(9,15)16)14(19,20)21-10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3 |
| InChIKey | BZJOPOGRDFRBDP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|