C12H14F4O — CID 144809522
2-(5,5,6,6-tetrafluoro-4-methylcyclohexa-1,3-dien-1-yl)oxane (PubChem CID 144809522) has the molecular formula C12H14F4O and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-(5,5,6,6-tetrafluoro-4-methylcyclohexa-1,3-dien-1-yl)oxane.
| Compound Name | 2-(5,5,6,6-tetrafluoro-4-methylcyclohexa-1,3-dien-1-yl)oxane |
|---|---|
| PubChem CID | 144809522 |
| Molecular Formula | C12H14F4O |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-(5,5,6,6-tetrafluoro-4-methylcyclohexa-1,3-dien-1-yl)oxane |
| SMILES | CC1=CC=C(C2CCCCO2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H14F4O/c1-8-5-6-9(10-4-2-3-7-17-10)12(15,16)11(8,13)14/h5-6,10H,2-4,7H2,1H3 |
| InChIKey | JZOKJZPDXAEJDY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|