C19H26F4O — CID 144809556
2-methyl-5-[5,5,6,6-tetrafluoro-4-(4-methylcyclohexyl)cyclohexa-1,3-dien-1-yl]oxane (PubChem CID 144809556) has the molecular formula C19H26F4O and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-methyl-5-[5,5,6,6-tetrafluoro-4-(4-methylcyclohexyl)cyclohexa-1,3-dien-1-yl]oxane.
| Compound Name | 2-methyl-5-[5,5,6,6-tetrafluoro-4-(4-methylcyclohexyl)cyclohexa-1,3-dien-1-yl]oxane |
|---|---|
| PubChem CID | 144809556 |
| Molecular Formula | C19H26F4O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-methyl-5-[5,5,6,6-tetrafluoro-4-(4-methylcyclohexyl)cyclohexa-1,3-dien-1-yl]oxane |
| SMILES | CC1CCC(C2=CC=C(C3CCC(C)OC3)C(F)(F)C2(F)F)CC1 |
| InChI | InChI=1S/C19H26F4O/c1-12-3-6-14(7-4-12)16-9-10-17(19(22,23)18(16,20)21)15-8-5-13(2)24-11-15/h9-10,12-15H,3-8,11H2,1-2H3 |
| InChIKey | SFOMCTVHEVGWQC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|