C18H21FN2O — CID 144810666
N-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-N'-(2-formylphenyl)-N-methylbutanimidamide (PubChem CID 144810666) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-N'-(2-formylphenyl)-N-methylbutanimidamide.
| Compound Name | N-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-N'-(2-formylphenyl)-N-methylbutanimidamide |
|---|---|
| PubChem CID | 144810666 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-N'-(2-formylphenyl)-N-methylbutanimidamide |
| SMILES | C=C/C=C(\C(=C)F)N(C)/C(CCC)=N/c1ccccc1C=O |
| InChI | InChI=1S/C18H21FN2O/c1-5-9-17(14(3)19)21(4)18(10-6-2)20-16-12-8-7-11-15(16)13-22/h5,7-9,11-13H,1,3,6,10H2,2,4H3/b17-9+,20-18+ |
| InChIKey | PIRHSNDVLAXGTN-MJXLJAMOSA-N |
| XLogP | 4.81 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|